About 1-adamantyl(trimethyl)azanium;hydroxide;hydrate
1-adamantyl(trimethyl)azanium;hydroxide;hydrate (PubChem CID 132987838) has the molecular formula C13H27NO2
and a molecular weight of 229.36 g/mol. Its IUPAC name is 1-adamantyl(trimethyl)azanium;hydroxide;hydrate.
Molecular Properties
| Compound Name | 1-adamantyl(trimethyl)azanium;hydroxide;hydrate |
| PubChem CID | 132987838 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 1-adamantyl(trimethyl)azanium;hydroxide;hydrate |
| SMILES | C[N+](C)(C)C12CC3CC(CC(C3)C1)C2.O.[OH-] |
| InChI | InChI=1S/C13H24N.2H2O/c1-14(2,3)13-7-10-4-11(8-13)6-12(5-10)9-13;;/h10-12H,4-9H2,1-3H3;2*1H2/q+1;;/p-1 |
| InChIKey | KAHFSFDBGXOSMZ-UHFFFAOYSA-M |
| XLogP | 1.66 |
| TPSA | 61.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-adamantyl(trimethyl)azanium;hydroxide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantyl(trimethyl)azanium;hydroxide;hydrate?
The IUPAC name of 1-adamantyl(trimethyl)azanium;hydroxide;hydrate (CID 132987838) is 1-adamantyl(trimethyl)azanium;hydroxide;hydrate.
What is the SMILES notation for 1-adamantyl(trimethyl)azanium;hydroxide;hydrate?
The canonical SMILES for 1-adamantyl(trimethyl)azanium;hydroxide;hydrate is C[N+](C)(C)C12CC3CC(CC(C3)C1)C2.O.[OH-].
What is the InChIKey of 1-adamantyl(trimethyl)azanium;hydroxide;hydrate?
The InChIKey is KAHFSFDBGXOSMZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H24N.2H2O/c1-14(2,3)13-7-10-4-11(8-13)6-12(5-10)9-13;;/h10-12H,4-9H2,1-3H3;2*1H2/q+1;;/p-1.
What are the key properties of 1-adamantyl(trimethyl)azanium;hydroxide;hydrate?
1-adamantyl(trimethyl)azanium;hydroxide;hydrate has a molecular weight of 229.36 g/mol, XLogP of 1.66, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantyl(trimethyl)azanium;hydroxide;hydrate is sourced from PubChem (CID 132987838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).