C22H29Br — CID 10785553
(1S,2E,3S,7S,9R)-4-bromo-2-[(5S,7R)-1-methyl-2-adamantylidene]tricyclo[5.3.1.03,9]undec-4-ene (PubChem CID 10785553) has the molecular formula C22H29Br and a molecular weight of 373.38 g/mol. Its IUPAC name is (1S,2E,3S,7S,9R)-4-bromo-2-[(5S,7R)-1-methyl-2-adamantylidene]tricyclo[5.3.1.03,9]undec-4-ene.
| Compound Name | (1S,2E,3S,7S,9R)-4-bromo-2-[(5S,7R)-1-methyl-2-adamantylidene]tricyclo[5.3.1.03,9]undec-4-ene |
|---|---|
| PubChem CID | 10785553 |
| Molecular Formula | C22H29Br |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (1S,2E,3S,7S,9R)-4-bromo-2-[(5S,7R)-1-methyl-2-adamantylidene]tricyclo[5.3.1.03,9]undec-4-ene |
| SMILES | CC12C[C@@H]3CC(C[C@@H](C3)C1)/C2=C1/[C@H]2C[C@H]3CC=C(Br)[C@H]1[C@H](C3)C2 |
| InChI | InChI=1S/C22H29Br/c1-22-10-13-4-14(11-22)8-17(7-13)21(22)20-16-6-12-2-3-18(23)19(20)15(5-12)9-16/h3,12-17,19H,2,4-11H2,1H3/b21-20+/t12-,13-,14+,15+,16-,17?,19+,22?/m0/s1 |
| InChIKey | PIORMYXVGAMXIU-OTVVXPHXSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|