C14H24O — CID 22670607
2,2-diethyladamantan-1-ol (PubChem CID 22670607) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is 2,2-diethyladamantan-1-ol.
| Compound Name | 2,2-diethyladamantan-1-ol |
|---|---|
| PubChem CID | 22670607 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 2,2-diethyladamantan-1-ol |
| SMILES | CCC1(CC)C2CC3CC(C2)CC1(O)C3 |
| InChI | InChI=1S/C14H24O/c1-3-13(4-2)12-6-10-5-11(7-12)9-14(13,15)8-10/h10-12,15H,3-9H2,1-2H3 |
| InChIKey | ZHKJUMKBHQYYQW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |