About 1-tert-butyl-3,7-dimethylbicyclo[3.3.1]nonan-3-ol
1-tert-butyl-3,7-dimethylbicyclo[3.3.1]nonan-3-ol (PubChem CID 91108760) has the molecular formula C15H28O
and a molecular weight of 224.39 g/mol. Its IUPAC name is 1-tert-butyl-3,7-dimethylbicyclo[3.3.1]nonan-3-ol.
Molecular Properties
| Compound Name | 1-tert-butyl-3,7-dimethylbicyclo[3.3.1]nonan-3-ol |
| PubChem CID | 91108760 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | 1-tert-butyl-3,7-dimethylbicyclo[3.3.1]nonan-3-ol |
| SMILES | CC1CC2CC(C)(O)CC(C(C)(C)C)(C1)C2 |
| InChI | InChI=1S/C15H28O/c1-11-6-12-8-14(5,16)10-15(7-11,9-12)13(2,3)4/h11-12,16H,6-10H2,1-5H3 |
| InChIKey | BSTBTUVGSBFDCU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-tert-butyl-3,7-dimethylbicyclo[3.3.1]nonan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3,7-dimethylbicyclo[3.3.1]nonan-3-ol?
The IUPAC name of 1-tert-butyl-3,7-dimethylbicyclo[3.3.1]nonan-3-ol (CID 91108760) is 1-tert-butyl-3,7-dimethylbicyclo[3.3.1]nonan-3-ol.
What is the SMILES notation for 1-tert-butyl-3,7-dimethylbicyclo[3.3.1]nonan-3-ol?
The canonical SMILES for 1-tert-butyl-3,7-dimethylbicyclo[3.3.1]nonan-3-ol is CC1CC2CC(C)(O)CC(C(C)(C)C)(C1)C2.
What is the InChIKey of 1-tert-butyl-3,7-dimethylbicyclo[3.3.1]nonan-3-ol?
The InChIKey is BSTBTUVGSBFDCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O/c1-11-6-12-8-14(5,16)10-15(7-11,9-12)13(2,3)4/h11-12,16H,6-10H2,1-5H3.
What are the key properties of 1-tert-butyl-3,7-dimethylbicyclo[3.3.1]nonan-3-ol?
1-tert-butyl-3,7-dimethylbicyclo[3.3.1]nonan-3-ol has a molecular weight of 224.39 g/mol, XLogP of 4.00, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3,7-dimethylbicyclo[3.3.1]nonan-3-ol is sourced from PubChem (CID 91108760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).