C17H30 — CID 11806605
(5S,7R)-1-tert-butyl-3-propan-2-yladamantane (PubChem CID 11806605) has the molecular formula C17H30 and a molecular weight of 234.43 g/mol. Its IUPAC name is (5S,7R)-1-tert-butyl-3-propan-2-yladamantane.
| Compound Name | (5S,7R)-1-tert-butyl-3-propan-2-yladamantane |
|---|---|
| PubChem CID | 11806605 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | (5S,7R)-1-tert-butyl-3-propan-2-yladamantane |
| SMILES | CC(C)C12C[C@H]3C[C@@H](C1)CC(C(C)(C)C)(C3)C2 |
| InChI | InChI=1S/C17H30/c1-12(2)16-7-13-6-14(8-16)10-17(9-13,11-16)15(3,4)5/h12-14H,6-11H2,1-5H3/t13-,14+,16?,17? |
| InChIKey | QSKGGGRPEIGDMD-CBHXASLJSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |