About adamantane
adamantane (PubChem CID 9238) has the molecular formula C10H16
and a molecular weight of 136.24 g/mol. Its IUPAC name is adamantane.
Molecular Properties
| Compound Name | adamantane |
| PubChem CID | 9238 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | adamantane |
| SMILES | C1C2CC3CC1CC(C2)C3 |
| InChI | InChI=1S/C10H16/c1-7-2-9-4-8(1)5-10(3-7)6-9/h7-10H,1-6H2 |
| InChIKey | ORILYTVJVMAKLC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze adamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane?
The IUPAC name of adamantane (CID 9238) is adamantane.
What is the SMILES notation for adamantane?
The canonical SMILES for adamantane is C1C2CC3CC1CC(C2)C3.
What is the InChIKey of adamantane?
The InChIKey is ORILYTVJVMAKLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16/c1-7-2-9-4-8(1)5-10(3-7)6-9/h7-10H,1-6H2.
What are the key properties of adamantane?
adamantane has a molecular weight of 136.24 g/mol, XLogP of 2.83, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane is sourced from PubChem (CID 9238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).