C13H23N — CID 170386418
5-tert-butyl-2-azatricyclo[3.3.1.13,7]decane (PubChem CID 170386418) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 5-tert-butyl-2-azatricyclo[3.3.1.13,7]decane.
| Compound Name | 5-tert-butyl-2-azatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 170386418 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 5-tert-butyl-2-azatricyclo[3.3.1.13,7]decane |
| SMILES | CC(C)(C)C12CC3CC(C1)NC(C3)C2 |
| InChI | InChI=1S/C13H23N/c1-12(2,3)13-6-9-4-10(7-13)14-11(5-9)8-13/h9-11,14H,4-8H2,1-3H3 |
| InChIKey | OFJYVDLICVLEPH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |