C10H16ClN — CID 24721241
(5S,7R)-3-chloroadamantan-1-amine (PubChem CID 24721241) has the molecular formula C10H16ClN and a molecular weight of 185.70 g/mol. Its IUPAC name is (5S,7R)-3-chloroadamantan-1-amine.
| Compound Name | (5S,7R)-3-chloroadamantan-1-amine |
|---|---|
| PubChem CID | 24721241 |
| Molecular Formula | C10H16ClN |
| Molecular Weight | 185.70 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | (5S,7R)-3-chloroadamantan-1-amine |
| SMILES | NC12C[C@H]3C[C@@H](C1)CC(Cl)(C3)C2 |
| InChI | InChI=1S/C10H16ClN/c11-9-2-7-1-8(3-9)5-10(12,4-7)6-9/h7-8H,1-6,12H2/t7-,8+,9?,10? |
| InChIKey | SPJODTPXLKRPMD-BQKDNTBBSA-N |
| XLogP | 2.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.70 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|