C12H21ClFN — CID 170907857
(5S,7R)-3-(2-fluoroethyl)adamantan-1-amine;hydrochloride (PubChem CID 170907857) has the molecular formula C12H21ClFN and a molecular weight of 233.76 g/mol. Its IUPAC name is (5S,7R)-3-(2-fluoroethyl)adamantan-1-amine;hydrochloride.
| Compound Name | (5S,7R)-3-(2-fluoroethyl)adamantan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 170907857 |
| Molecular Formula | C12H21ClFN |
| Molecular Weight | 233.76 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | (5S,7R)-3-(2-fluoroethyl)adamantan-1-amine;hydrochloride |
| SMILES | Cl.NC12C[C@H]3C[C@@H](C1)CC(CCF)(C3)C2 |
| InChI | InChI=1S/C12H20FN.ClH/c13-2-1-11-4-9-3-10(5-11)7-12(14,6-9)8-11;/h9-10H,1-8,14H2;1H/t9-,10+,11?,12?; |
| InChIKey | KPURUIUXBWTRPB-QZIWBCHOSA-N |
| XLogP | 3.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.76 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |