About (1-amino-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl) [4-(methoxyamino)phenyl] carbonate
(1-amino-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl) [4-(methoxyamino)phenyl] carbonate (PubChem CID 174306600) has the molecular formula C19H28N2O4
and a molecular weight of 348.44 g/mol. Its IUPAC name is (1-amino-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl) [4-(methoxyamino)phenyl] carbonate.
Molecular Properties
| Compound Name | (1-amino-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl) [4-(methoxyamino)phenyl] carbonate |
| PubChem CID | 174306600 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (1-amino-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl) [4-(methoxyamino)phenyl] carbonate |
| SMILES | CONc1ccc(OC(=O)OC2(C)CC3CC(C)CC(N)(C3)C2)cc1 |
| InChI | InChI=1S/C19H28N2O4/c1-13-8-14-10-18(2,12-19(20,9-13)11-14)25-17(22)24-16-6-4-15(5-7-16)21-23-3/h4-7,13-14,21H,8-12,20H2,1-3H3 |
| InChIKey | CRMWIBXQJWJAGE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (1-amino-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl) [4-(methoxyamino)phenyl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-amino-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl) [4-(methoxyamino)phenyl] carbonate?
The IUPAC name of (1-amino-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl) [4-(methoxyamino)phenyl] carbonate (CID 174306600) is (1-amino-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl) [4-(methoxyamino)phenyl] carbonate.
What is the SMILES notation for (1-amino-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl) [4-(methoxyamino)phenyl] carbonate?
The canonical SMILES for (1-amino-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl) [4-(methoxyamino)phenyl] carbonate is CONc1ccc(OC(=O)OC2(C)CC3CC(C)CC(N)(C3)C2)cc1.
What is the InChIKey of (1-amino-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl) [4-(methoxyamino)phenyl] carbonate?
The InChIKey is CRMWIBXQJWJAGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N2O4/c1-13-8-14-10-18(2,12-19(20,9-13)11-14)25-17(22)24-16-6-4-15(5-7-16)21-23-3/h4-7,13-14,21H,8-12,20H2,1-3H3.
What are the key properties of (1-amino-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl) [4-(methoxyamino)phenyl] carbonate?
(1-amino-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl) [4-(methoxyamino)phenyl] carbonate has a molecular weight of 348.44 g/mol, XLogP of 3.86, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-amino-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl) [4-(methoxyamino)phenyl] carbonate is sourced from PubChem (CID 174306600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).