C20H18N2O4S2 — CID 178111550
[4-(methoxyamino)phenyl] [4-(pyridin-2-yldisulfanyl)phenyl]methyl carbonate (PubChem CID 178111550) has the molecular formula C20H18N2O4S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is [4-(methoxyamino)phenyl] [4-(pyridin-2-yldisulfanyl)phenyl]methyl carbonate.
| Compound Name | [4-(methoxyamino)phenyl] [4-(pyridin-2-yldisulfanyl)phenyl]methyl carbonate |
|---|---|
| PubChem CID | 178111550 |
| Molecular Formula | C20H18N2O4S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | [4-(methoxyamino)phenyl] [4-(pyridin-2-yldisulfanyl)phenyl]methyl carbonate |
| SMILES | CONc1ccc(OC(=O)OCc2ccc(SSc3ccccn3)cc2)cc1 |
| InChI | InChI=1S/C20H18N2O4S2/c1-24-22-16-7-9-17(10-8-16)26-20(23)25-14-15-5-11-18(12-6-15)27-28-19-4-2-3-13-21-19/h2-13,22H,14H2,1H3 |
| InChIKey | YNEXSRWCNSMVQD-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|