C20H25NO6S — CID 155451406
[4-(2,2-dimethylpropoxysulfanyloxy)phenyl]methyl [4-(methoxyamino)phenyl] carbonate (PubChem CID 155451406) has the molecular formula C20H25NO6S and a molecular weight of 407.49 g/mol. Its IUPAC name is [4-(2,2-dimethylpropoxysulfanyloxy)phenyl]methyl [4-(methoxyamino)phenyl] carbonate.
| Compound Name | [4-(2,2-dimethylpropoxysulfanyloxy)phenyl]methyl [4-(methoxyamino)phenyl] carbonate |
|---|---|
| PubChem CID | 155451406 |
| Molecular Formula | C20H25NO6S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | [4-(2,2-dimethylpropoxysulfanyloxy)phenyl]methyl [4-(methoxyamino)phenyl] carbonate |
| SMILES | CONc1ccc(OC(=O)OCc2ccc(OSOCC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H25NO6S/c1-20(2,3)14-25-28-27-18-9-5-15(6-10-18)13-24-19(22)26-17-11-7-16(8-12-17)21-23-4/h5-12,21H,13-14H2,1-4H3 |
| InChIKey | DWUUWVUYVKSCJF-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|