C18H24N2O3 — CID 11141631
[(5S,7R)-3-amino-1-adamantyl] N-(4-methoxyphenyl)carbamate (PubChem CID 11141631) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is [(5S,7R)-3-amino-1-adamantyl] N-(4-methoxyphenyl)carbamate.
| Compound Name | [(5S,7R)-3-amino-1-adamantyl] N-(4-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 11141631 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | [(5S,7R)-3-amino-1-adamantyl] N-(4-methoxyphenyl)carbamate |
| SMILES | COc1ccc(NC(=O)OC23C[C@@H]4C[C@@H](CC(N)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C18H24N2O3/c1-22-15-4-2-14(3-5-15)20-16(21)23-18-9-12-6-13(10-18)8-17(19,7-12)11-18/h2-5,12-13H,6-11,19H2,1H3,(H,20,21)/t12-,13+,17?,18? |
| InChIKey | CBAJSEJQCLKPFL-NLKGSNSHSA-N |
| XLogP | 3.29 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |