About [3-(aziridin-2-yl)-3,5-dimethylcyclohexyl] (Z)-but-2-enoate
[3-(aziridin-2-yl)-3,5-dimethylcyclohexyl] (Z)-but-2-enoate (PubChem CID 163939821) has the molecular formula C14H23NO2
and a molecular weight of 237.34 g/mol. Its IUPAC name is [3-(aziridin-2-yl)-3,5-dimethylcyclohexyl] (Z)-but-2-enoate.
Molecular Properties
| Compound Name | [3-(aziridin-2-yl)-3,5-dimethylcyclohexyl] (Z)-but-2-enoate |
| PubChem CID | 163939821 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | [3-(aziridin-2-yl)-3,5-dimethylcyclohexyl] (Z)-but-2-enoate |
| SMILES | C/C=C\C(=O)OC1CC(C)CC(C)(C2CN2)C1 |
| InChI | InChI=1S/C14H23NO2/c1-4-5-13(16)17-11-6-10(2)7-14(3,8-11)12-9-15-12/h4-5,10-12,15H,6-9H2,1-3H3/b5-4- |
| InChIKey | RQARYWPOIFYVMX-PLNGDYQASA-N |
| XLogP | 2.27 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [3-(aziridin-2-yl)-3,5-dimethylcyclohexyl] (Z)-but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(aziridin-2-yl)-3,5-dimethylcyclohexyl] (Z)-but-2-enoate?
The IUPAC name of [3-(aziridin-2-yl)-3,5-dimethylcyclohexyl] (Z)-but-2-enoate (CID 163939821) is [3-(aziridin-2-yl)-3,5-dimethylcyclohexyl] (Z)-but-2-enoate.
What is the SMILES notation for [3-(aziridin-2-yl)-3,5-dimethylcyclohexyl] (Z)-but-2-enoate?
The canonical SMILES for [3-(aziridin-2-yl)-3,5-dimethylcyclohexyl] (Z)-but-2-enoate is C/C=C\C(=O)OC1CC(C)CC(C)(C2CN2)C1.
What is the InChIKey of [3-(aziridin-2-yl)-3,5-dimethylcyclohexyl] (Z)-but-2-enoate?
The InChIKey is RQARYWPOIFYVMX-PLNGDYQASA-N. The full InChI is InChI=1S/C14H23NO2/c1-4-5-13(16)17-11-6-10(2)7-14(3,8-11)12-9-15-12/h4-5,10-12,15H,6-9H2,1-3H3/b5-4-.
What are the key properties of [3-(aziridin-2-yl)-3,5-dimethylcyclohexyl] (Z)-but-2-enoate?
[3-(aziridin-2-yl)-3,5-dimethylcyclohexyl] (Z)-but-2-enoate has a molecular weight of 237.34 g/mol, XLogP of 2.27, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(aziridin-2-yl)-3,5-dimethylcyclohexyl] (Z)-but-2-enoate is sourced from PubChem (CID 163939821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).