C14H25NO2 — CID 78923050
(3,3,5-trimethylcyclohexyl) (2R)-pyrrolidine-2-carboxylate (PubChem CID 78923050) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is (3,3,5-trimethylcyclohexyl) (2R)-pyrrolidine-2-carboxylate.
| Compound Name | (3,3,5-trimethylcyclohexyl) (2R)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 78923050 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | (3,3,5-trimethylcyclohexyl) (2R)-pyrrolidine-2-carboxylate |
| SMILES | CC1CC(OC(=O)[C@H]2CCCN2)CC(C)(C)C1 |
| InChI | InChI=1S/C14H25NO2/c1-10-7-11(9-14(2,3)8-10)17-13(16)12-5-4-6-15-12/h10-12,15H,4-9H2,1-3H3/t10?,11?,12-/m1/s1 |
| InChIKey | RBKGPMUIWWIHKD-HTAVTVPLSA-N |
| XLogP | 2.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |