C16H29NO2 — CID 64563078
(3,3,5-trimethylcyclohexyl) azepane-2-carboxylate (PubChem CID 64563078) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is (3,3,5-trimethylcyclohexyl) azepane-2-carboxylate.
| Compound Name | (3,3,5-trimethylcyclohexyl) azepane-2-carboxylate |
|---|---|
| PubChem CID | 64563078 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | (3,3,5-trimethylcyclohexyl) azepane-2-carboxylate |
| SMILES | CC1CC(OC(=O)C2CCCCCN2)CC(C)(C)C1 |
| InChI | InChI=1S/C16H29NO2/c1-12-9-13(11-16(2,3)10-12)19-15(18)14-7-5-4-6-8-17-14/h12-14,17H,4-11H2,1-3H3 |
| InChIKey | KCABQHXJXOFIOF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |