About cycloheptyl (2R)-piperidine-2-carboxylate
cycloheptyl (2R)-piperidine-2-carboxylate (PubChem CID 79034969) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is cycloheptyl (2R)-piperidine-2-carboxylate.
Molecular Properties
| Compound Name | cycloheptyl (2R)-piperidine-2-carboxylate |
| PubChem CID | 79034969 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | cycloheptyl (2R)-piperidine-2-carboxylate |
| SMILES | O=C(OC1CCCCCC1)[C@H]1CCCCN1 |
| InChI | InChI=1S/C13H23NO2/c15-13(12-9-5-6-10-14-12)16-11-7-3-1-2-4-8-11/h11-12,14H,1-10H2/t12-/m1/s1 |
| InChIKey | LJIYQSPHPMVJCM-GFCCVEGCSA-N |
| XLogP | 2.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cycloheptyl (2R)-piperidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cycloheptyl (2R)-piperidine-2-carboxylate?
The IUPAC name of cycloheptyl (2R)-piperidine-2-carboxylate (CID 79034969) is cycloheptyl (2R)-piperidine-2-carboxylate.
What is the SMILES notation for cycloheptyl (2R)-piperidine-2-carboxylate?
The canonical SMILES for cycloheptyl (2R)-piperidine-2-carboxylate is O=C(OC1CCCCCC1)[C@H]1CCCCN1.
What is the InChIKey of cycloheptyl (2R)-piperidine-2-carboxylate?
The InChIKey is LJIYQSPHPMVJCM-GFCCVEGCSA-N. The full InChI is InChI=1S/C13H23NO2/c15-13(12-9-5-6-10-14-12)16-11-7-3-1-2-4-8-11/h11-12,14H,1-10H2/t12-/m1/s1.
What are the key properties of cycloheptyl (2R)-piperidine-2-carboxylate?
cycloheptyl (2R)-piperidine-2-carboxylate has a molecular weight of 225.33 g/mol, XLogP of 2.39, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cycloheptyl (2R)-piperidine-2-carboxylate is sourced from PubChem (CID 79034969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).