C13H21NO2 — CID 69384389
[(5S)-5-methylpyrrolidin-3-yl] octa-2,6-dienoate (PubChem CID 69384389) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is [(5S)-5-methylpyrrolidin-3-yl] octa-2,6-dienoate.
| Compound Name | [(5S)-5-methylpyrrolidin-3-yl] octa-2,6-dienoate |
|---|---|
| PubChem CID | 69384389 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | [(5S)-5-methylpyrrolidin-3-yl] octa-2,6-dienoate |
| SMILES | CC=CCCC=CC(=O)OC1CN[C@@H](C)C1 |
| InChI | InChI=1S/C13H21NO2/c1-3-4-5-6-7-8-13(15)16-12-9-11(2)14-10-12/h3-4,7-8,11-12,14H,5-6,9-10H2,1-2H3/t11-,12?/m0/s1 |
| InChIKey | MAIGOZJXURYDGO-PXYINDEMSA-N |
| XLogP | 2.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|