C12H18O4 — CID 68942605
(E)-4-(3,5-dimethylcyclohexyl)oxy-4-oxobut-2-enoic acid (PubChem CID 68942605) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is (E)-4-(3,5-dimethylcyclohexyl)oxy-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-(3,5-dimethylcyclohexyl)oxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 68942605 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (E)-4-(3,5-dimethylcyclohexyl)oxy-4-oxobut-2-enoic acid |
| SMILES | CC1CC(C)CC(OC(=O)/C=C/C(=O)O)C1 |
| InChI | InChI=1S/C12H18O4/c1-8-5-9(2)7-10(6-8)16-12(15)4-3-11(13)14/h3-4,8-10H,5-7H2,1-2H3,(H,13,14)/b4-3+ |
| InChIKey | TUBAQBDNSRXIIJ-ONEGZZNKSA-N |
| XLogP | 2.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|