C13H18O4 — CID 161318836
4-[[(1R,3aR,4R,6aS)-4-methyl-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]oxy]-4-oxobut-2-enoic acid (PubChem CID 161318836) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is 4-[[(1R,3aR,4R,6aS)-4-methyl-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]oxy]-4-oxobut-2-enoic acid.
| Compound Name | 4-[[(1R,3aR,4R,6aS)-4-methyl-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]oxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 161318836 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 4-[[(1R,3aR,4R,6aS)-4-methyl-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]oxy]-4-oxobut-2-enoic acid |
| SMILES | C[C@@H]1CC[C@H]2[C@@H]1CC[C@H]2OC(=O)C=CC(=O)O |
| InChI | InChI=1S/C13H18O4/c1-8-2-3-10-9(8)4-5-11(10)17-13(16)7-6-12(14)15/h6-11H,2-5H2,1H3,(H,14,15)/t8-,9-,10+,11-/m1/s1 |
| InChIKey | PYYSYBTWPIXVFS-CHWFTXMASA-N |
| XLogP | 2.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|