C10H13NO6 — CID 69012356
(E)-4-(2-carbamoyloxan-4-yl)oxy-4-oxobut-2-enoic acid (PubChem CID 69012356) has the molecular formula C10H13NO6 and a molecular weight of 243.21 g/mol. Its IUPAC name is (E)-4-(2-carbamoyloxan-4-yl)oxy-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-(2-carbamoyloxan-4-yl)oxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 69012356 |
| Molecular Formula | C10H13NO6 |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | (E)-4-(2-carbamoyloxan-4-yl)oxy-4-oxobut-2-enoic acid |
| SMILES | NC(=O)C1CC(OC(=O)/C=C/C(=O)O)CCO1 |
| InChI | InChI=1S/C10H13NO6/c11-10(15)7-5-6(3-4-16-7)17-9(14)2-1-8(12)13/h1-2,6-7H,3-5H2,(H2,11,15)(H,12,13)/b2-1+ |
| InChIKey | ZPACOQWTZLHUKN-OWOJBTEDSA-N |
| XLogP | -0.80 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|