C8H16N2O3 — CID 171841038
6-methoxy-1,4-oxazocane-2-carboxamide (PubChem CID 171841038) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is 6-methoxy-1,4-oxazocane-2-carboxamide.
| Compound Name | 6-methoxy-1,4-oxazocane-2-carboxamide |
|---|---|
| PubChem CID | 171841038 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 6-methoxy-1,4-oxazocane-2-carboxamide |
| SMILES | COC1CCOC(C(N)=O)CNC1 |
| InChI | InChI=1S/C8H16N2O3/c1-12-6-2-3-13-7(8(9)11)5-10-4-6/h6-7,10H,2-5H2,1H3,(H2,9,11) |
| InChIKey | ZMAVEEWVPIQTKV-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |