C11H19NO2 — CID 144639404
(2,2,6-trimethylpiperidin-4-yl) prop-2-enoate (PubChem CID 144639404) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is (2,2,6-trimethylpiperidin-4-yl) prop-2-enoate.
| Compound Name | (2,2,6-trimethylpiperidin-4-yl) prop-2-enoate |
|---|---|
| PubChem CID | 144639404 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | (2,2,6-trimethylpiperidin-4-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC1CC(C)NC(C)(C)C1 |
| InChI | InChI=1S/C11H19NO2/c1-5-10(13)14-9-6-8(2)12-11(3,4)7-9/h5,8-9,12H,1,6-7H2,2-4H3 |
| InChIKey | RIGYLTRLCNVBNI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|