C25H34 — CID 145407369
1-ethenyl-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-[(2E,4Z)-hexa-2,4-dien-3-yl]-3,3-dimethyl-2-[(Z)-prop-1-enyl]cyclopentene (PubChem CID 145407369) has the molecular formula C25H34 and a molecular weight of 334.55 g/mol. Its IUPAC name is 1-ethenyl-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-[(2E,4Z)-hexa-2,4-dien-3-yl]-3,3-dimethyl-2-[(Z)-prop-1-enyl]cyclopentene.
| Compound Name | 1-ethenyl-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-[(2E,4Z)-hexa-2,4-dien-3-yl]-3,3-dimethyl-2-[(Z)-prop-1-enyl]cyclopentene |
|---|---|
| PubChem CID | 145407369 |
| Molecular Formula | C25H34 |
| Molecular Weight | 334.55 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | 1-ethenyl-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-[(2E,4Z)-hexa-2,4-dien-3-yl]-3,3-dimethyl-2-[(Z)-prop-1-enyl]cyclopentene |
| SMILES | C=C/C=C(\C=C/C)C1(C(/C=C\C)=C/C)CC(C)(C)C(/C=C\C)=C1C=C |
| InChI | InChI=1S/C25H34/c1-9-15-20(13-5)25(21(16-10-2)17-11-3)19-24(7,8)23(18-12-4)22(25)14-6/h9-18H,2,6,19H2,1,3-5,7-8H3/b15-9-,17-11-,18-12-,20-13+,21-16+ |
| InChIKey | PLPOSPKOJICGRK-NPHYTXLJSA-N |
| XLogP | 7.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.55 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|