C33H36 — CID 174026626
1-[(1Z)-buta-1,3-dienyl]-2-ethenyl-5-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]-5-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-3,4-bis[(Z)-prop-1-enyl]cyclopenta-1,3-diene (PubChem CID 174026626) has the molecular formula C33H36 and a molecular weight of 432.65 g/mol. Its IUPAC name is 1-[(1Z)-buta-1,3-dienyl]-2-ethenyl-5-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]-5-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-3,4-bis[(Z)-prop-1-enyl]cyclopenta-1,3-diene.
| Compound Name | 1-[(1Z)-buta-1,3-dienyl]-2-ethenyl-5-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]-5-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-3,4-bis[(Z)-prop-1-enyl]cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 174026626 |
| Molecular Formula | C33H36 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | 1-[(1Z)-buta-1,3-dienyl]-2-ethenyl-5-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]-5-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-3,4-bis[(Z)-prop-1-enyl]cyclopenta-1,3-diene |
| SMILES | C=C/C=C\C=C(/C=C)C1(C(/C=C\C=C)=C/C=C)C(/C=C\C=C)=C(C=C)C(/C=C\C)=C1/C=C\C |
| InChI | InChI=1S/C33H36/c1-9-17-20-25-27(15-7)33(28(21-12-4)24-18-10-2)31(23-14-6)30(22-13-5)29(16-8)32(33)26-19-11-3/h9-26H,1-4,7-8H2,5-6H3/b20-17-,22-13-,23-14-,24-18-,26-19-,27-25+,28-21+ |
| InChIKey | BUYFMCSUEGCMDW-IVGDTBSWSA-N |
| XLogP | 9.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|