C22H32N+ — CID 170600539
4-[1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3,3,5-trimethylcyclohexyl]-1-methylpyridin-1-ium (PubChem CID 170600539) has the molecular formula C22H32N+ and a molecular weight of 310.51 g/mol. Its IUPAC name is 4-[1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3,3,5-trimethylcyclohexyl]-1-methylpyridin-1-ium.
| Compound Name | 4-[1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3,3,5-trimethylcyclohexyl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 170600539 |
| Molecular Formula | C22H32N+ |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | 4-[1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3,3,5-trimethylcyclohexyl]-1-methylpyridin-1-ium |
| SMILES | C=C/C=C(\C=C/C)C1(c2cc[n+](C)cc2)CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C22H32N/c1-7-9-19(10-8-2)22(20-11-13-23(6)14-12-20)16-18(3)15-21(4,5)17-22/h7-14,18H,1,15-17H2,2-6H3/q+1/b10-8-,19-9+ |
| InChIKey | BEUCWRLKVSVITH-NVRFOIDBSA-N |
| XLogP | 5.28 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|