C9H16F2 — CID 124582887
(5R)-1,1-difluoro-3,3,5-trimethylcyclohexane (PubChem CID 124582887) has the molecular formula C9H16F2 and a molecular weight of 162.22 g/mol. Its IUPAC name is (5R)-1,1-difluoro-3,3,5-trimethylcyclohexane.
| Compound Name | (5R)-1,1-difluoro-3,3,5-trimethylcyclohexane |
|---|---|
| PubChem CID | 124582887 |
| Molecular Formula | C9H16F2 |
| Molecular Weight | 162.22 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (5R)-1,1-difluoro-3,3,5-trimethylcyclohexane |
| SMILES | C[C@@H]1CC(C)(C)CC(F)(F)C1 |
| InChI | InChI=1S/C9H16F2/c1-7-4-8(2,3)6-9(10,11)5-7/h7H,4-6H2,1-3H3/t7-/m1/s1 |
| InChIKey | YHPPEZDHPLYDJK-SSDOTTSWSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.22 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |