C11H22O — CID 134996054
(1R)-1-ethyl-3,3,5-trimethylcyclohexan-1-ol (PubChem CID 134996054) has the molecular formula C11H22O and a molecular weight of 170.30 g/mol. Its IUPAC name is (1R)-1-ethyl-3,3,5-trimethylcyclohexan-1-ol.
| Compound Name | (1R)-1-ethyl-3,3,5-trimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 134996054 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | (1R)-1-ethyl-3,3,5-trimethylcyclohexan-1-ol |
| SMILES | CC[C@@]1(O)CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C11H22O/c1-5-11(12)7-9(2)6-10(3,4)8-11/h9,12H,5-8H2,1-4H3/t9?,11-/m1/s1 |
| InChIKey | YGFGIINUFVLBLJ-HCCKASOXSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |