C14H28O3S — CID 65147372
1-(3-ethylsulfonylpropyl)-3,3,5-trimethylcyclohexan-1-ol (PubChem CID 65147372) has the molecular formula C14H28O3S and a molecular weight of 276.44 g/mol. Its IUPAC name is 1-(3-ethylsulfonylpropyl)-3,3,5-trimethylcyclohexan-1-ol.
| Compound Name | 1-(3-ethylsulfonylpropyl)-3,3,5-trimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 65147372 |
| Molecular Formula | C14H28O3S |
| Molecular Weight | 276.44 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 1-(3-ethylsulfonylpropyl)-3,3,5-trimethylcyclohexan-1-ol |
| SMILES | CCS(=O)(=O)CCCC1(O)CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C14H28O3S/c1-5-18(16,17)8-6-7-14(15)10-12(2)9-13(3,4)11-14/h12,15H,5-11H2,1-4H3 |
| InChIKey | OQFIINDTZPNODS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |