C12H24O3S — CID 126656791
4-(2,2-dimethylpentyl)-1,1-dioxothian-4-ol (PubChem CID 126656791) has the molecular formula C12H24O3S and a molecular weight of 248.39 g/mol. Its IUPAC name is 4-(2,2-dimethylpentyl)-1,1-dioxothian-4-ol.
| Compound Name | 4-(2,2-dimethylpentyl)-1,1-dioxothian-4-ol |
|---|---|
| PubChem CID | 126656791 |
| Molecular Formula | C12H24O3S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 4-(2,2-dimethylpentyl)-1,1-dioxothian-4-ol |
| SMILES | CCCC(C)(C)CC1(O)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H24O3S/c1-4-5-11(2,3)10-12(13)6-8-16(14,15)9-7-12/h13H,4-10H2,1-3H3 |
| InChIKey | USCCWUFDMLHTHP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |