About 4-(2,2-dimethylpentyl)-1,1-dioxothian-4-ol
4-(2,2-dimethylpentyl)-1,1-dioxothian-4-ol (PubChem CID 126656791) has the molecular formula C12H24O3S
and a molecular weight of 248.39 g/mol. Its IUPAC name is 4-(2,2-dimethylpentyl)-1,1-dioxothian-4-ol.
Molecular Properties
| Compound Name | 4-(2,2-dimethylpentyl)-1,1-dioxothian-4-ol |
| PubChem CID | 126656791 |
| Molecular Formula | C12H24O3S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 4-(2,2-dimethylpentyl)-1,1-dioxothian-4-ol |
| SMILES | CCCC(C)(C)CC1(O)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H24O3S/c1-4-5-11(2,3)10-12(13)6-8-16(14,15)9-7-12/h13H,4-10H2,1-3H3 |
| InChIKey | USCCWUFDMLHTHP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,2-dimethylpentyl)-1,1-dioxothian-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-dimethylpentyl)-1,1-dioxothian-4-ol?
The IUPAC name of 4-(2,2-dimethylpentyl)-1,1-dioxothian-4-ol (CID 126656791) is 4-(2,2-dimethylpentyl)-1,1-dioxothian-4-ol.
What is the SMILES notation for 4-(2,2-dimethylpentyl)-1,1-dioxothian-4-ol?
The canonical SMILES for 4-(2,2-dimethylpentyl)-1,1-dioxothian-4-ol is CCCC(C)(C)CC1(O)CCS(=O)(=O)CC1.
What is the InChIKey of 4-(2,2-dimethylpentyl)-1,1-dioxothian-4-ol?
The InChIKey is USCCWUFDMLHTHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O3S/c1-4-5-11(2,3)10-12(13)6-8-16(14,15)9-7-12/h13H,4-10H2,1-3H3.
What are the key properties of 4-(2,2-dimethylpentyl)-1,1-dioxothian-4-ol?
4-(2,2-dimethylpentyl)-1,1-dioxothian-4-ol has a molecular weight of 248.39 g/mol, XLogP of 2.14, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dimethylpentyl)-1,1-dioxothian-4-ol is sourced from PubChem (CID 126656791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).