C13H25Br — CID 143368968
1-bromo-3,3,5-trimethyl-1-(2-methylpropyl)cyclohexane (PubChem CID 143368968) has the molecular formula C13H25Br and a molecular weight of 261.25 g/mol. Its IUPAC name is 1-bromo-3,3,5-trimethyl-1-(2-methylpropyl)cyclohexane.
| Compound Name | 1-bromo-3,3,5-trimethyl-1-(2-methylpropyl)cyclohexane |
|---|---|
| PubChem CID | 143368968 |
| Molecular Formula | C13H25Br |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 1-bromo-3,3,5-trimethyl-1-(2-methylpropyl)cyclohexane |
| SMILES | CC(C)CC1(Br)CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C13H25Br/c1-10(2)6-13(14)8-11(3)7-12(4,5)9-13/h10-11H,6-9H2,1-5H3 |
| InChIKey | YCEFGPNJCOSPMI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|