C10H8F6 — CID 142500496
1-ethenyl-3,3,4,4,5,5-hexafluoro-2-[(Z)-prop-1-enyl]cyclopentene (PubChem CID 142500496) has the molecular formula C10H8F6 and a molecular weight of 242.16 g/mol. Its IUPAC name is 1-ethenyl-3,3,4,4,5,5-hexafluoro-2-[(Z)-prop-1-enyl]cyclopentene.
| Compound Name | 1-ethenyl-3,3,4,4,5,5-hexafluoro-2-[(Z)-prop-1-enyl]cyclopentene |
|---|---|
| PubChem CID | 142500496 |
| Molecular Formula | C10H8F6 |
| Molecular Weight | 242.16 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 1-ethenyl-3,3,4,4,5,5-hexafluoro-2-[(Z)-prop-1-enyl]cyclopentene |
| SMILES | C=CC1=C(/C=C\C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H8F6/c1-3-5-7-6(4-2)8(11,12)10(15,16)9(7,13)14/h3-5H,2H2,1H3/b5-3- |
| InChIKey | JXUXFXGMHFYULU-HYXAFXHYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.16 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|