C9H14O — CID 549059
1-buta-1,3-dien-2-ylcyclopentan-1-ol (PubChem CID 549059) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is 1-buta-1,3-dien-2-ylcyclopentan-1-ol.
| Compound Name | 1-buta-1,3-dien-2-ylcyclopentan-1-ol |
|---|---|
| PubChem CID | 549059 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | 1-buta-1,3-dien-2-ylcyclopentan-1-ol |
| SMILES | C=CC(=C)C1(O)CCCC1 |
| InChI | InChI=1S/C9H14O/c1-3-8(2)9(10)6-4-5-7-9/h3,10H,1-2,4-7H2 |
| InChIKey | GRWNATDKHJYDTF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|