C19H22F2O — CID 143134262
(3E,5E)-6-[1-(3,4-difluorophenyl)cyclohexyl]hepta-1,3,5-trien-3-ol (PubChem CID 143134262) has the molecular formula C19H22F2O and a molecular weight of 304.38 g/mol. Its IUPAC name is (3E,5E)-6-[1-(3,4-difluorophenyl)cyclohexyl]hepta-1,3,5-trien-3-ol.
| Compound Name | (3E,5E)-6-[1-(3,4-difluorophenyl)cyclohexyl]hepta-1,3,5-trien-3-ol |
|---|---|
| PubChem CID | 143134262 |
| Molecular Formula | C19H22F2O |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (3E,5E)-6-[1-(3,4-difluorophenyl)cyclohexyl]hepta-1,3,5-trien-3-ol |
| SMILES | C=C/C(O)=C\C=C(/C)C1(c2ccc(F)c(F)c2)CCCCC1 |
| InChI | InChI=1S/C19H22F2O/c1-3-16(22)9-7-14(2)19(11-5-4-6-12-19)15-8-10-17(20)18(21)13-15/h3,7-10,13,22H,1,4-6,11-12H2,2H3/b14-7+,16-9+ |
| InChIKey | PFLCMLBDLCSVTI-APTFWKJFSA-N |
| XLogP | 5.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|