C12H13FO2S — CID 84800517
1-(3-fluoro-4-methylsulfanylphenyl)cyclobutane-1-carboxylic acid (PubChem CID 84800517) has the molecular formula C12H13FO2S and a molecular weight of 240.30 g/mol. Its IUPAC name is 1-(3-fluoro-4-methylsulfanylphenyl)cyclobutane-1-carboxylic acid.
| Compound Name | 1-(3-fluoro-4-methylsulfanylphenyl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 84800517 |
| Molecular Formula | C12H13FO2S |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 1-(3-fluoro-4-methylsulfanylphenyl)cyclobutane-1-carboxylic acid |
| SMILES | CSc1ccc(C2(C(=O)O)CCC2)cc1F |
| InChI | InChI=1S/C12H13FO2S/c1-16-10-4-3-8(7-9(10)13)12(11(14)15)5-2-6-12/h3-4,7H,2,5-6H2,1H3,(H,14,15) |
| InChIKey | HKFUPJPYSUKPNH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |