C17H23FO2 — CID 117446490
1-(3-fluoro-4-pentan-3-ylphenyl)cyclopentane-1-carboxylic acid (PubChem CID 117446490) has the molecular formula C17H23FO2 and a molecular weight of 278.37 g/mol. Its IUPAC name is 1-(3-fluoro-4-pentan-3-ylphenyl)cyclopentane-1-carboxylic acid.
| Compound Name | 1-(3-fluoro-4-pentan-3-ylphenyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 117446490 |
| Molecular Formula | C17H23FO2 |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1-(3-fluoro-4-pentan-3-ylphenyl)cyclopentane-1-carboxylic acid |
| SMILES | CCC(CC)c1ccc(C2(C(=O)O)CCCC2)cc1F |
| InChI | InChI=1S/C17H23FO2/c1-3-12(4-2)14-8-7-13(11-15(14)18)17(16(19)20)9-5-6-10-17/h7-8,11-12H,3-6,9-10H2,1-2H3,(H,19,20) |
| InChIKey | OMFRYRXQFJBQPP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |