C18H17FO2 — CID 117457844
1-(4-fluoro-3-phenylphenyl)cyclopentane-1-carboxylic acid (PubChem CID 117457844) has the molecular formula C18H17FO2 and a molecular weight of 284.33 g/mol. Its IUPAC name is 1-(4-fluoro-3-phenylphenyl)cyclopentane-1-carboxylic acid.
| Compound Name | 1-(4-fluoro-3-phenylphenyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 117457844 |
| Molecular Formula | C18H17FO2 |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 1-(4-fluoro-3-phenylphenyl)cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2ccc(F)c(-c3ccccc3)c2)CCCC1 |
| InChI | InChI=1S/C18H17FO2/c19-16-9-8-14(18(17(20)21)10-4-5-11-18)12-15(16)13-6-2-1-3-7-13/h1-3,6-9,12H,4-5,10-11H2,(H,20,21) |
| InChIKey | HAWRAYUGXKTAGZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |