C15H17FO4S — CID 117497632
1-(4-cyclopropylsulfonyl-3-fluorophenyl)cyclopentane-1-carboxylic acid (PubChem CID 117497632) has the molecular formula C15H17FO4S and a molecular weight of 312.36 g/mol. Its IUPAC name is 1-(4-cyclopropylsulfonyl-3-fluorophenyl)cyclopentane-1-carboxylic acid.
| Compound Name | 1-(4-cyclopropylsulfonyl-3-fluorophenyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 117497632 |
| Molecular Formula | C15H17FO4S |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 1-(4-cyclopropylsulfonyl-3-fluorophenyl)cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2ccc(S(=O)(=O)C3CC3)c(F)c2)CCCC1 |
| InChI | InChI=1S/C15H17FO4S/c16-12-9-10(15(14(17)18)7-1-2-8-15)3-6-13(12)21(19,20)11-4-5-11/h3,6,9,11H,1-2,4-5,7-8H2,(H,17,18) |
| InChIKey | WFTDEJIKSRFSAL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |