C10H11FO3S — CID 84693412
(4-cyclopropylsulfonyl-3-fluorophenyl)methanol (PubChem CID 84693412) has the molecular formula C10H11FO3S and a molecular weight of 230.26 g/mol. Its IUPAC name is (4-cyclopropylsulfonyl-3-fluorophenyl)methanol.
| Compound Name | (4-cyclopropylsulfonyl-3-fluorophenyl)methanol |
|---|---|
| PubChem CID | 84693412 |
| Molecular Formula | C10H11FO3S |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | (4-cyclopropylsulfonyl-3-fluorophenyl)methanol |
| SMILES | O=S(=O)(c1ccc(CO)cc1F)C1CC1 |
| InChI | InChI=1S/C10H11FO3S/c11-9-5-7(6-12)1-4-10(9)15(13,14)8-2-3-8/h1,4-5,8,12H,2-3,6H2 |
| InChIKey | DZDITGLLBFJGBY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |