C12H15FO4S — CID 117438220
3-[3-fluoro-4-(oxetan-3-ylsulfonyl)phenyl]propan-1-ol (PubChem CID 117438220) has the molecular formula C12H15FO4S and a molecular weight of 274.31 g/mol. Its IUPAC name is 3-[3-fluoro-4-(oxetan-3-ylsulfonyl)phenyl]propan-1-ol.
| Compound Name | 3-[3-fluoro-4-(oxetan-3-ylsulfonyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 117438220 |
| Molecular Formula | C12H15FO4S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 3-[3-fluoro-4-(oxetan-3-ylsulfonyl)phenyl]propan-1-ol |
| SMILES | O=S(=O)(c1ccc(CCCO)cc1F)C1COC1 |
| InChI | InChI=1S/C12H15FO4S/c13-11-6-9(2-1-5-14)3-4-12(11)18(15,16)10-7-17-8-10/h3-4,6,10,14H,1-2,5,7-8H2 |
| InChIKey | XGZYLWGFMCFISA-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |