C12H15FOS — CID 117325748
3-(4-cyclopropylsulfanyl-3-fluorophenyl)propan-1-ol (PubChem CID 117325748) has the molecular formula C12H15FOS and a molecular weight of 226.32 g/mol. Its IUPAC name is 3-(4-cyclopropylsulfanyl-3-fluorophenyl)propan-1-ol.
| Compound Name | 3-(4-cyclopropylsulfanyl-3-fluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 117325748 |
| Molecular Formula | C12H15FOS |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 3-(4-cyclopropylsulfanyl-3-fluorophenyl)propan-1-ol |
| SMILES | OCCCc1ccc(SC2CC2)c(F)c1 |
| InChI | InChI=1S/C12H15FOS/c13-11-8-9(2-1-7-14)3-6-12(11)15-10-4-5-10/h3,6,8,10,14H,1-2,4-5,7H2 |
| InChIKey | CJPKJASYFPCTBM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |