C15H20FNO3S — CID 117498745
1-[3-fluoro-4-(oxetan-3-ylsulfonyl)phenyl]cyclohexan-1-amine (PubChem CID 117498745) has the molecular formula C15H20FNO3S and a molecular weight of 313.39 g/mol. Its IUPAC name is 1-[3-fluoro-4-(oxetan-3-ylsulfonyl)phenyl]cyclohexan-1-amine.
| Compound Name | 1-[3-fluoro-4-(oxetan-3-ylsulfonyl)phenyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 117498745 |
| Molecular Formula | C15H20FNO3S |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 1-[3-fluoro-4-(oxetan-3-ylsulfonyl)phenyl]cyclohexan-1-amine |
| SMILES | NC1(c2ccc(S(=O)(=O)C3COC3)c(F)c2)CCCCC1 |
| InChI | InChI=1S/C15H20FNO3S/c16-13-8-11(15(17)6-2-1-3-7-15)4-5-14(13)21(18,19)12-9-20-10-12/h4-5,8,12H,1-3,6-7,9-10,17H2 |
| InChIKey | ULKSSWUICIGSJW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |