C14H21NO2S2 — CID 117482499
1-(4-methylsulfanyl-3-methylsulfonylphenyl)cyclohexan-1-amine (PubChem CID 117482499) has the molecular formula C14H21NO2S2 and a molecular weight of 299.46 g/mol. Its IUPAC name is 1-(4-methylsulfanyl-3-methylsulfonylphenyl)cyclohexan-1-amine.
| Compound Name | 1-(4-methylsulfanyl-3-methylsulfonylphenyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 117482499 |
| Molecular Formula | C14H21NO2S2 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 1-(4-methylsulfanyl-3-methylsulfonylphenyl)cyclohexan-1-amine |
| SMILES | CSc1ccc(C2(N)CCCCC2)cc1S(C)(=O)=O |
| InChI | InChI=1S/C14H21NO2S2/c1-18-12-7-6-11(10-13(12)19(2,16)17)14(15)8-4-3-5-9-14/h6-7,10H,3-5,8-9,15H2,1-2H3 |
| InChIKey | LJCICIFMYGOVSO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |