C12H16O3S2 — CID 117434012
1-[(4-methylsulfanyl-3-methylsulfonylphenyl)methyl]cyclopropan-1-ol (PubChem CID 117434012) has the molecular formula C12H16O3S2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 1-[(4-methylsulfanyl-3-methylsulfonylphenyl)methyl]cyclopropan-1-ol.
| Compound Name | 1-[(4-methylsulfanyl-3-methylsulfonylphenyl)methyl]cyclopropan-1-ol |
|---|---|
| PubChem CID | 117434012 |
| Molecular Formula | C12H16O3S2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 1-[(4-methylsulfanyl-3-methylsulfonylphenyl)methyl]cyclopropan-1-ol |
| SMILES | CSc1ccc(CC2(O)CC2)cc1S(C)(=O)=O |
| InChI | InChI=1S/C12H16O3S2/c1-16-10-4-3-9(8-12(13)5-6-12)7-11(10)17(2,14)15/h3-4,7,13H,5-6,8H2,1-2H3 |
| InChIKey | HNNCOLPBIHOPBB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |