C12H16OS — CID 117298022
1-[(3-methyl-4-methylsulfanylphenyl)methyl]cyclopropan-1-ol (PubChem CID 117298022) has the molecular formula C12H16OS and a molecular weight of 208.33 g/mol. Its IUPAC name is 1-[(3-methyl-4-methylsulfanylphenyl)methyl]cyclopropan-1-ol.
| Compound Name | 1-[(3-methyl-4-methylsulfanylphenyl)methyl]cyclopropan-1-ol |
|---|---|
| PubChem CID | 117298022 |
| Molecular Formula | C12H16OS |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 1-[(3-methyl-4-methylsulfanylphenyl)methyl]cyclopropan-1-ol |
| SMILES | CSc1ccc(CC2(O)CC2)cc1C |
| InChI | InChI=1S/C12H16OS/c1-9-7-10(3-4-11(9)14-2)8-12(13)5-6-12/h3-4,7,13H,5-6,8H2,1-2H3 |
| InChIKey | FUUVILNTVOYBDM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |