C11H13F2NO2S — CID 117407145
1-(2,5-difluoro-3-methylsulfonylphenyl)cyclobutan-1-amine (PubChem CID 117407145) has the molecular formula C11H13F2NO2S and a molecular weight of 261.29 g/mol. Its IUPAC name is 1-(2,5-difluoro-3-methylsulfonylphenyl)cyclobutan-1-amine.
| Compound Name | 1-(2,5-difluoro-3-methylsulfonylphenyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 117407145 |
| Molecular Formula | C11H13F2NO2S |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 1-(2,5-difluoro-3-methylsulfonylphenyl)cyclobutan-1-amine |
| SMILES | CS(=O)(=O)c1cc(F)cc(C2(N)CCC2)c1F |
| InChI | InChI=1S/C11H13F2NO2S/c1-17(15,16)9-6-7(12)5-8(10(9)13)11(14)3-2-4-11/h5-6H,2-4,14H2,1H3 |
| InChIKey | OGDLAIWRAYUFLE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |