C11H9F2NO3S — CID 117435316
2,5-difluoro-1-(1-isocyanatocyclopropyl)-3-methylsulfonylbenzene (PubChem CID 117435316) has the molecular formula C11H9F2NO3S and a molecular weight of 273.26 g/mol. Its IUPAC name is 2,5-difluoro-1-(1-isocyanatocyclopropyl)-3-methylsulfonylbenzene.
| Compound Name | 2,5-difluoro-1-(1-isocyanatocyclopropyl)-3-methylsulfonylbenzene |
|---|---|
| PubChem CID | 117435316 |
| Molecular Formula | C11H9F2NO3S |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 2,5-difluoro-1-(1-isocyanatocyclopropyl)-3-methylsulfonylbenzene |
| SMILES | CS(=O)(=O)c1cc(F)cc(C2(N=C=O)CC2)c1F |
| InChI | InChI=1S/C11H9F2NO3S/c1-18(16,17)9-5-7(12)4-8(10(9)13)11(2-3-11)14-6-15/h4-5H,2-3H2,1H3 |
| InChIKey | LYBMIACFCPIRMI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|