C13H15NO5S — CID 117478870
1-(1-isocyanatocyclopropyl)-2,5-dimethoxy-3-methylsulfonylbenzene (PubChem CID 117478870) has the molecular formula C13H15NO5S and a molecular weight of 297.33 g/mol. Its IUPAC name is 1-(1-isocyanatocyclopropyl)-2,5-dimethoxy-3-methylsulfonylbenzene.
| Compound Name | 1-(1-isocyanatocyclopropyl)-2,5-dimethoxy-3-methylsulfonylbenzene |
|---|---|
| PubChem CID | 117478870 |
| Molecular Formula | C13H15NO5S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 1-(1-isocyanatocyclopropyl)-2,5-dimethoxy-3-methylsulfonylbenzene |
| SMILES | COc1cc(C2(N=C=O)CC2)c(OC)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C13H15NO5S/c1-18-9-6-10(13(4-5-13)14-8-15)12(19-2)11(7-9)20(3,16)17/h6-7H,4-5H2,1-3H3 |
| InChIKey | CEDBNPCXJCRLSU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|