C14H17NO5S — CID 117496207
1-(1-isocyanatocyclobutyl)-4,5-dimethoxy-2-methylsulfonylbenzene (PubChem CID 117496207) has the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. Its IUPAC name is 1-(1-isocyanatocyclobutyl)-4,5-dimethoxy-2-methylsulfonylbenzene.
| Compound Name | 1-(1-isocyanatocyclobutyl)-4,5-dimethoxy-2-methylsulfonylbenzene |
|---|---|
| PubChem CID | 117496207 |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 1-(1-isocyanatocyclobutyl)-4,5-dimethoxy-2-methylsulfonylbenzene |
| SMILES | COc1cc(C2(N=C=O)CCC2)c(S(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C14H17NO5S/c1-19-11-7-10(14(15-9-16)5-4-6-14)13(21(3,17)18)8-12(11)20-2/h7-8H,4-6H2,1-3H3 |
| InChIKey | JTNAKWATEZZJAD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|