C13H15NO3S — CID 117417500
1-(1-isocyanatocyclopropyl)-4,5-dimethyl-2-methylsulfonylbenzene (PubChem CID 117417500) has the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. Its IUPAC name is 1-(1-isocyanatocyclopropyl)-4,5-dimethyl-2-methylsulfonylbenzene.
| Compound Name | 1-(1-isocyanatocyclopropyl)-4,5-dimethyl-2-methylsulfonylbenzene |
|---|---|
| PubChem CID | 117417500 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 1-(1-isocyanatocyclopropyl)-4,5-dimethyl-2-methylsulfonylbenzene |
| SMILES | Cc1cc(C2(N=C=O)CC2)c(S(C)(=O)=O)cc1C |
| InChI | InChI=1S/C13H15NO3S/c1-9-6-11(13(4-5-13)14-8-15)12(7-10(9)2)18(3,16)17/h6-7H,4-5H2,1-3H3 |
| InChIKey | QLUCSVMOXZAVMY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|